C26H27N5O6 — CID 143990023
6-methoxy-2-methyl-3H-isoindol-1-one;methyl (NE,1Z)-N-[[2-(4-methyl-2,5-dioxoimidazolidin-4-yl)-1-benzofuran-6-yl]methylidene]ethanehydrazonate (PubChem CID 143990023) has the molecular formula C26H27N5O6 and a molecular weight of 505.53 g/mol. Its IUPAC name is 6-methoxy-2-methyl-3H-isoindol-1-one;methyl (NE,1Z)-N-[[2-(4-methyl-2,5-dioxoimidazolidin-4-yl)-1-benzofuran-6-yl]methylidene]ethanehydrazonate.
| Compound Name | 6-methoxy-2-methyl-3H-isoindol-1-one;methyl (NE,1Z)-N-[[2-(4-methyl-2,5-dioxoimidazolidin-4-yl)-1-benzofuran-6-yl]methylidene]ethanehydrazonate |
|---|---|
| PubChem CID | 143990023 |
| Molecular Formula | C26H27N5O6 |
| Molecular Weight | 505.53 g/mol |
| Exact Mass | 505.20 |
| IUPAC Name | 6-methoxy-2-methyl-3H-isoindol-1-one;methyl (NE,1Z)-N-[[2-(4-methyl-2,5-dioxoimidazolidin-4-yl)-1-benzofuran-6-yl]methylidene]ethanehydrazonate |
| SMILES | CO/C(C)=N\N=C\c1ccc2cc(C3(C)NC(=O)NC3=O)oc2c1.COc1ccc2c(c1)C(=O)N(C)C2 |
| InChI | InChI=1S/C16H16N4O4.C10H11NO2/c1-9(23-3)20-17-8-10-4-5-11-7-13(24-12(11)6-10)16(2)14(21)18-15(22)19-16;1-11-6-7-3-4-8(13-2)5-9(7)10(11)12/h4-8H,1-3H3,(H2,18,19,21,22);3-5H,6H2,1-2H3/b17-8+,20-9-; |
| InChIKey | MFXUGBCUZTWPEV-TVECKGKCSA-N |
| XLogP | 3.17 |
| TPSA | 134.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.53 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|