C19H14N4O6 — CID 90894646
5-(5-methoxy-3-oxo-1H-isoindol-2-yl)-5-(5-oxo-4H-furo[3,2-b]pyridin-2-yl)imidazolidine-2,4-dione (PubChem CID 90894646) has the molecular formula C19H14N4O6 and a molecular weight of 394.34 g/mol. Its IUPAC name is 5-(5-methoxy-3-oxo-1H-isoindol-2-yl)-5-(5-oxo-4H-furo[3,2-b]pyridin-2-yl)imidazolidine-2,4-dione.
| Compound Name | 5-(5-methoxy-3-oxo-1H-isoindol-2-yl)-5-(5-oxo-4H-furo[3,2-b]pyridin-2-yl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 90894646 |
| Molecular Formula | C19H14N4O6 |
| Molecular Weight | 394.34 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | 5-(5-methoxy-3-oxo-1H-isoindol-2-yl)-5-(5-oxo-4H-furo[3,2-b]pyridin-2-yl)imidazolidine-2,4-dione |
| SMILES | COc1ccc2c(c1)C(=O)N(C1(c3cc4[nH]c(=O)ccc4o3)NC(=O)NC1=O)C2 |
| InChI | InChI=1S/C19H14N4O6/c1-28-10-3-2-9-8-23(16(25)11(9)6-10)19(17(26)21-18(27)22-19)14-7-12-13(29-14)4-5-15(24)20-12/h2-7H,8H2,1H3,(H,20,24)(H2,21,22,26,27) |
| InChIKey | RLWAVVXLQAZHPR-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 133.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.34 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|