C17H20ClNO4 — CID 155122690
methyl 6-chloro-7-ethyl-3-(3-methoxy-3-oxopropyl)-1-methylindole-2-carboxylate (PubChem CID 155122690) has the molecular formula C17H20ClNO4 and a molecular weight of 337.80 g/mol. Its IUPAC name is methyl 6-chloro-7-ethyl-3-(3-methoxy-3-oxopropyl)-1-methylindole-2-carboxylate.
| Compound Name | methyl 6-chloro-7-ethyl-3-(3-methoxy-3-oxopropyl)-1-methylindole-2-carboxylate |
|---|---|
| PubChem CID | 155122690 |
| Molecular Formula | C17H20ClNO4 |
| Molecular Weight | 337.80 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | methyl 6-chloro-7-ethyl-3-(3-methoxy-3-oxopropyl)-1-methylindole-2-carboxylate |
| SMILES | CCc1c(Cl)ccc2c(CCC(=O)OC)c(C(=O)OC)n(C)c12 |
| InChI | InChI=1S/C17H20ClNO4/c1-5-10-13(18)8-6-11-12(7-9-14(20)22-3)16(17(21)23-4)19(2)15(10)11/h6,8H,5,7,9H2,1-4H3 |
| InChIKey | UGZKCFKIABOPKU-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.80 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|