C31H46ClN3O6Si — CID 169027418
methyl 3-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-6-chloro-7-[4-(hydroxymethyl)-1-methylpyrazol-5-yl]-1-[2-(oxan-2-yloxy)ethyl]indole-2-carboxylate (PubChem CID 169027418) has the molecular formula C31H46ClN3O6Si and a molecular weight of 620.26 g/mol. Its IUPAC name is methyl 3-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-6-chloro-7-[4-(hydroxymethyl)-1-methylpyrazol-5-yl]-1-[2-(oxan-2-yloxy)ethyl]indole-2-carboxylate.
| Compound Name | methyl 3-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-6-chloro-7-[4-(hydroxymethyl)-1-methylpyrazol-5-yl]-1-[2-(oxan-2-yloxy)ethyl]indole-2-carboxylate |
|---|---|
| PubChem CID | 169027418 |
| Molecular Formula | C31H46ClN3O6Si |
| Molecular Weight | 620.26 g/mol |
| Exact Mass | 619.28 |
| IUPAC Name | methyl 3-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-6-chloro-7-[4-(hydroxymethyl)-1-methylpyrazol-5-yl]-1-[2-(oxan-2-yloxy)ethyl]indole-2-carboxylate |
| SMILES | COC(=O)c1c(CCCO[Si](C)(C)C(C)(C)C)c2ccc(Cl)c(-c3c(CO)cnn3C)c2n1CCOC1CCCCO1 |
| InChI | InChI=1S/C31H46ClN3O6Si/c1-31(2,3)42(6,7)41-17-10-11-22-23-13-14-24(32)26(27-21(20-36)19-33-34(27)4)28(23)35(29(22)30(37)38-5)15-18-40-25-12-8-9-16-39-25/h13-14,19,25,36H,8-12,15-18,20H2,1-7H3 |
| InChIKey | DDBNGVBMNWHHHC-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.26 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|