C26H37ClIN3O3Si — CID 163282802
methyl 1-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-5-chloro-4-[3-(iodomethyl)-1,5-dimethylpyrazol-4-yl]-3-methylindole-2-carboxylate (PubChem CID 163282802) has the molecular formula C26H37ClIN3O3Si and a molecular weight of 630.04 g/mol. Its IUPAC name is methyl 1-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-5-chloro-4-[3-(iodomethyl)-1,5-dimethylpyrazol-4-yl]-3-methylindole-2-carboxylate.
| Compound Name | methyl 1-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-5-chloro-4-[3-(iodomethyl)-1,5-dimethylpyrazol-4-yl]-3-methylindole-2-carboxylate |
|---|---|
| PubChem CID | 163282802 |
| Molecular Formula | C26H37ClIN3O3Si |
| Molecular Weight | 630.04 g/mol |
| Exact Mass | 629.13 |
| IUPAC Name | methyl 1-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-5-chloro-4-[3-(iodomethyl)-1,5-dimethylpyrazol-4-yl]-3-methylindole-2-carboxylate |
| SMILES | COC(=O)c1c(C)c2c(-c3c(CI)nn(C)c3C)c(Cl)ccc2n1CCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H37ClIN3O3Si/c1-16-21-20(12-11-18(27)23(21)22-17(2)30(6)29-19(22)15-28)31(24(16)25(32)33-7)13-10-14-34-35(8,9)26(3,4)5/h11-12H,10,13-15H2,1-9H3 |
| InChIKey | KKYZDJPDEHBKHX-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 58.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.04 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|