C16H21FO3 — CID 170686633
3-(1-tert-butylcyclopentyl)oxy-4-fluorobenzoic acid (PubChem CID 170686633) has the molecular formula C16H21FO3 and a molecular weight of 280.34 g/mol. Its IUPAC name is 3-(1-tert-butylcyclopentyl)oxy-4-fluorobenzoic acid.
| Compound Name | 3-(1-tert-butylcyclopentyl)oxy-4-fluorobenzoic acid |
|---|---|
| PubChem CID | 170686633 |
| Molecular Formula | C16H21FO3 |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 3-(1-tert-butylcyclopentyl)oxy-4-fluorobenzoic acid |
| SMILES | CC(C)(C)C1(Oc2cc(C(=O)O)ccc2F)CCCC1 |
| InChI | InChI=1S/C16H21FO3/c1-15(2,3)16(8-4-5-9-16)20-13-10-11(14(18)19)6-7-12(13)17/h6-7,10H,4-5,8-9H2,1-3H3,(H,18,19) |
| InChIKey | LFUKGWYCBZQYQK-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |