C19H27FO6S — CID 177112329
2-[3-(1-tert-butylcyclohexyl)oxy-4-fluorobenzoyl]oxyethanesulfonic acid (PubChem CID 177112329) has the molecular formula C19H27FO6S and a molecular weight of 402.48 g/mol. Its IUPAC name is 2-[3-(1-tert-butylcyclohexyl)oxy-4-fluorobenzoyl]oxyethanesulfonic acid.
| Compound Name | 2-[3-(1-tert-butylcyclohexyl)oxy-4-fluorobenzoyl]oxyethanesulfonic acid |
|---|---|
| PubChem CID | 177112329 |
| Molecular Formula | C19H27FO6S |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | 2-[3-(1-tert-butylcyclohexyl)oxy-4-fluorobenzoyl]oxyethanesulfonic acid |
| SMILES | CC(C)(C)C1(Oc2cc(C(=O)OCCS(=O)(=O)O)ccc2F)CCCCC1 |
| InChI | InChI=1S/C19H27FO6S/c1-18(2,3)19(9-5-4-6-10-19)26-16-13-14(7-8-15(16)20)17(21)25-11-12-27(22,23)24/h7-8,13H,4-6,9-12H2,1-3H3,(H,22,23,24) |
| InChIKey | DYURVEYRKOUBSO-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|