C20H25FO6S — CID 177112105
2-[3-(4-cyclohexyl-2-methylbut-3-yn-2-yl)oxy-4-fluorobenzoyl]oxyethanesulfonic acid (PubChem CID 177112105) has the molecular formula C20H25FO6S and a molecular weight of 412.48 g/mol. Its IUPAC name is 2-[3-(4-cyclohexyl-2-methylbut-3-yn-2-yl)oxy-4-fluorobenzoyl]oxyethanesulfonic acid.
| Compound Name | 2-[3-(4-cyclohexyl-2-methylbut-3-yn-2-yl)oxy-4-fluorobenzoyl]oxyethanesulfonic acid |
|---|---|
| PubChem CID | 177112105 |
| Molecular Formula | C20H25FO6S |
| Molecular Weight | 412.48 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | 2-[3-(4-cyclohexyl-2-methylbut-3-yn-2-yl)oxy-4-fluorobenzoyl]oxyethanesulfonic acid |
| SMILES | CC(C)(C#CC1CCCCC1)Oc1cc(C(=O)OCCS(=O)(=O)O)ccc1F |
| InChI | InChI=1S/C20H25FO6S/c1-20(2,11-10-15-6-4-3-5-7-15)27-18-14-16(8-9-17(18)21)19(22)26-12-13-28(23,24)25/h8-9,14-15H,3-7,12-13H2,1-2H3,(H,23,24,25) |
| InChIKey | CQPXOKHJBGEAAS-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.48 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|