C19H21F3O7S — CID 177112027
2-[3-(1-cyclopropyl-3-methylpent-1-yn-3-yl)oxy-4-(trifluoromethoxy)benzoyl]oxyethanesulfonic acid (PubChem CID 177112027) has the molecular formula C19H21F3O7S and a molecular weight of 450.43 g/mol. Its IUPAC name is 2-[3-(1-cyclopropyl-3-methylpent-1-yn-3-yl)oxy-4-(trifluoromethoxy)benzoyl]oxyethanesulfonic acid.
| Compound Name | 2-[3-(1-cyclopropyl-3-methylpent-1-yn-3-yl)oxy-4-(trifluoromethoxy)benzoyl]oxyethanesulfonic acid |
|---|---|
| PubChem CID | 177112027 |
| Molecular Formula | C19H21F3O7S |
| Molecular Weight | 450.43 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | 2-[3-(1-cyclopropyl-3-methylpent-1-yn-3-yl)oxy-4-(trifluoromethoxy)benzoyl]oxyethanesulfonic acid |
| SMILES | CCC(C)(C#CC1CC1)Oc1cc(C(=O)OCCS(=O)(=O)O)ccc1OC(F)(F)F |
| InChI | InChI=1S/C19H21F3O7S/c1-3-18(2,9-8-13-4-5-13)28-16-12-14(6-7-15(16)29-19(20,21)22)17(23)27-10-11-30(24,25)26/h6-7,12-13H,3-5,10-11H2,1-2H3,(H,24,25,26) |
| InChIKey | PVEMTIMAMACVQQ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.43 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|