C17H19F3O7S — CID 177111867
2-[3-(3-methylhex-4-yn-3-yloxy)-4-(trifluoromethoxy)benzoyl]oxyethanesulfonic acid (PubChem CID 177111867) has the molecular formula C17H19F3O7S and a molecular weight of 424.39 g/mol. Its IUPAC name is 2-[3-(3-methylhex-4-yn-3-yloxy)-4-(trifluoromethoxy)benzoyl]oxyethanesulfonic acid.
| Compound Name | 2-[3-(3-methylhex-4-yn-3-yloxy)-4-(trifluoromethoxy)benzoyl]oxyethanesulfonic acid |
|---|---|
| PubChem CID | 177111867 |
| Molecular Formula | C17H19F3O7S |
| Molecular Weight | 424.39 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | 2-[3-(3-methylhex-4-yn-3-yloxy)-4-(trifluoromethoxy)benzoyl]oxyethanesulfonic acid |
| SMILES | CC#CC(C)(CC)Oc1cc(C(=O)OCCS(=O)(=O)O)ccc1OC(F)(F)F |
| InChI | InChI=1S/C17H19F3O7S/c1-4-8-16(3,5-2)26-14-11-12(6-7-13(14)27-17(18,19)20)15(21)25-9-10-28(22,23)24/h6-7,11H,5,9-10H2,1-3H3,(H,22,23,24) |
| InChIKey | ZUHRUQNYPHDFLA-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.39 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|