C13H17FO7S — CID 177111171
2-[3-(1-ethoxyethoxy)-4-fluorobenzoyl]oxyethanesulfonic acid (PubChem CID 177111171) has the molecular formula C13H17FO7S and a molecular weight of 336.34 g/mol. Its IUPAC name is 2-[3-(1-ethoxyethoxy)-4-fluorobenzoyl]oxyethanesulfonic acid.
| Compound Name | 2-[3-(1-ethoxyethoxy)-4-fluorobenzoyl]oxyethanesulfonic acid |
|---|---|
| PubChem CID | 177111171 |
| Molecular Formula | C13H17FO7S |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | 2-[3-(1-ethoxyethoxy)-4-fluorobenzoyl]oxyethanesulfonic acid |
| SMILES | CCOC(C)Oc1cc(C(=O)OCCS(=O)(=O)O)ccc1F |
| InChI | InChI=1S/C13H17FO7S/c1-3-19-9(2)21-12-8-10(4-5-11(12)14)13(15)20-6-7-22(16,17)18/h4-5,8-9H,3,6-7H2,1-2H3,(H,16,17,18) |
| InChIKey | DRDMOGLKWZRNCY-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|