C17H24FO7S- — CID 177111700
2-[4-fluoro-3-[2-methyl-1-(2-methylpropoxy)propoxy]benzoyl]oxyethanesulfonate (PubChem CID 177111700) has the molecular formula C17H24FO7S- and a molecular weight of 391.44 g/mol. Its IUPAC name is 2-[4-fluoro-3-[2-methyl-1-(2-methylpropoxy)propoxy]benzoyl]oxyethanesulfonate.
| Compound Name | 2-[4-fluoro-3-[2-methyl-1-(2-methylpropoxy)propoxy]benzoyl]oxyethanesulfonate |
|---|---|
| PubChem CID | 177111700 |
| Molecular Formula | C17H24FO7S- |
| Molecular Weight | 391.44 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | 2-[4-fluoro-3-[2-methyl-1-(2-methylpropoxy)propoxy]benzoyl]oxyethanesulfonate |
| SMILES | CC(C)COC(Oc1cc(C(=O)OCCS(=O)(=O)[O-])ccc1F)C(C)C |
| InChI | InChI=1S/C17H25FO7S/c1-11(2)10-24-17(12(3)4)25-15-9-13(5-6-14(15)18)16(19)23-7-8-26(20,21)22/h5-6,9,11-12,17H,7-8,10H2,1-4H3,(H,20,21,22)/p-1 |
| InChIKey | GWUYPHIYMRYPBF-UHFFFAOYSA-M |
| XLogP | 2.56 |
| TPSA | 101.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.44 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|