C17H19FO6S — CID 177111158
2-[3-(1-ethynylcyclohexyl)oxy-4-fluorobenzoyl]oxyethanesulfonic acid (PubChem CID 177111158) has the molecular formula C17H19FO6S and a molecular weight of 370.40 g/mol. Its IUPAC name is 2-[3-(1-ethynylcyclohexyl)oxy-4-fluorobenzoyl]oxyethanesulfonic acid.
| Compound Name | 2-[3-(1-ethynylcyclohexyl)oxy-4-fluorobenzoyl]oxyethanesulfonic acid |
|---|---|
| PubChem CID | 177111158 |
| Molecular Formula | C17H19FO6S |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | 2-[3-(1-ethynylcyclohexyl)oxy-4-fluorobenzoyl]oxyethanesulfonic acid |
| SMILES | C#CC1(Oc2cc(C(=O)OCCS(=O)(=O)O)ccc2F)CCCCC1 |
| InChI | InChI=1S/C17H19FO6S/c1-2-17(8-4-3-5-9-17)24-15-12-13(6-7-14(15)18)16(19)23-10-11-25(20,21)22/h1,6-7,12H,3-5,8-11H2,(H,20,21,22) |
| InChIKey | HHNIWNANZBIDSV-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|