C19H21FO6S2 — CID 177112061
2-[4-fluoro-3-[(2-prop-1-en-2-yl-7-thiatricyclo[3.2.1.03,6]octan-2-yl)oxy]benzoyl]oxyethanesulfonic acid (PubChem CID 177112061) has the molecular formula C19H21FO6S2 and a molecular weight of 428.50 g/mol. Its IUPAC name is 2-[4-fluoro-3-[(2-prop-1-en-2-yl-7-thiatricyclo[3.2.1.03,6]octan-2-yl)oxy]benzoyl]oxyethanesulfonic acid.
| Compound Name | 2-[4-fluoro-3-[(2-prop-1-en-2-yl-7-thiatricyclo[3.2.1.03,6]octan-2-yl)oxy]benzoyl]oxyethanesulfonic acid |
|---|---|
| PubChem CID | 177112061 |
| Molecular Formula | C19H21FO6S2 |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | 2-[4-fluoro-3-[(2-prop-1-en-2-yl-7-thiatricyclo[3.2.1.03,6]octan-2-yl)oxy]benzoyl]oxyethanesulfonic acid |
| SMILES | C=C(C)C1(Oc2cc(C(=O)OCCS(=O)(=O)O)ccc2F)C2CC3CC1C3S2 |
| InChI | InChI=1S/C19H21FO6S2/c1-10(2)19(13-7-12-9-16(19)27-17(12)13)26-15-8-11(3-4-14(15)20)18(21)25-5-6-28(22,23)24/h3-4,8,12-13,16-17H,1,5-7,9H2,2H3,(H,22,23,24) |
| InChIKey | RNIMJQOCVUGEGB-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|