C25H27FO3S — CID 177111138
phenyl 4-fluoro-3-[(4-propan-2-yl-10-thiatricyclo[5.2.1.02,6]decan-4-yl)oxy]benzoate (PubChem CID 177111138) has the molecular formula C25H27FO3S and a molecular weight of 426.55 g/mol. Its IUPAC name is phenyl 4-fluoro-3-[(4-propan-2-yl-10-thiatricyclo[5.2.1.02,6]decan-4-yl)oxy]benzoate.
| Compound Name | phenyl 4-fluoro-3-[(4-propan-2-yl-10-thiatricyclo[5.2.1.02,6]decan-4-yl)oxy]benzoate |
|---|---|
| PubChem CID | 177111138 |
| Molecular Formula | C25H27FO3S |
| Molecular Weight | 426.55 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | phenyl 4-fluoro-3-[(4-propan-2-yl-10-thiatricyclo[5.2.1.02,6]decan-4-yl)oxy]benzoate |
| SMILES | CC(C)C1(Oc2cc(C(=O)Oc3ccccc3)ccc2F)CC2C3CCC(S3)C2C1 |
| InChI | InChI=1S/C25H27FO3S/c1-15(2)25(13-18-19(14-25)23-11-10-22(18)30-23)29-21-12-16(8-9-20(21)26)24(27)28-17-6-4-3-5-7-17/h3-9,12,15,18-19,22-23H,10-11,13-14H2,1-2H3 |
| InChIKey | MNAWFGANTDZYOH-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.55 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|