C20H24FO3- — CID 170686124
4-fluoro-3-[(8-propan-2-yl-8-tricyclo[5.2.1.02,6]decanyl)oxy]benzoate (PubChem CID 170686124) has the molecular formula C20H24FO3- and a molecular weight of 331.41 g/mol. Its IUPAC name is 4-fluoro-3-[(8-propan-2-yl-8-tricyclo[5.2.1.02,6]decanyl)oxy]benzoate.
| Compound Name | 4-fluoro-3-[(8-propan-2-yl-8-tricyclo[5.2.1.02,6]decanyl)oxy]benzoate |
|---|---|
| PubChem CID | 170686124 |
| Molecular Formula | C20H24FO3- |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | 4-fluoro-3-[(8-propan-2-yl-8-tricyclo[5.2.1.02,6]decanyl)oxy]benzoate |
| SMILES | CC(C)C1(Oc2cc(C(=O)[O-])ccc2F)CC2CC1C1CCCC21 |
| InChI | InChI=1S/C20H25FO3/c1-11(2)20(10-13-8-16(20)15-5-3-4-14(13)15)24-18-9-12(19(22)23)6-7-17(18)21/h6-7,9,11,13-16H,3-5,8,10H2,1-2H3,(H,22,23)/p-1 |
| InChIKey | GOAMEOVOYPDBIC-UHFFFAOYSA-M |
| XLogP | 3.42 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |