C24H24FOS+ — CID 170523414
[4-(1-ethylcyclobutyl)oxy-3-fluorophenyl]-diphenylsulfanium (PubChem CID 170523414) has the molecular formula C24H24FOS+ and a molecular weight of 379.52 g/mol. Its IUPAC name is [4-(1-ethylcyclobutyl)oxy-3-fluorophenyl]-diphenylsulfanium.
| Compound Name | [4-(1-ethylcyclobutyl)oxy-3-fluorophenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 170523414 |
| Molecular Formula | C24H24FOS+ |
| Molecular Weight | 379.52 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | [4-(1-ethylcyclobutyl)oxy-3-fluorophenyl]-diphenylsulfanium |
| SMILES | CCC1(Oc2ccc([S+](c3ccccc3)c3ccccc3)cc2F)CCC1 |
| InChI | InChI=1S/C24H24FOS/c1-2-24(16-9-17-24)26-23-15-14-21(18-22(23)25)27(19-10-5-3-6-11-19)20-12-7-4-8-13-20/h3-8,10-15,18H,2,9,16-17H2,1H3/q+1 |
| InChIKey | CUKGORJWNODQQY-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.52 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|