C25H20FO3S+ — CID 169050571
[4-[2-(1-ethynylcyclopropyl)oxy-2-oxoethoxy]-3-fluorophenyl]-diphenylsulfanium (PubChem CID 169050571) has the molecular formula C25H20FO3S+ and a molecular weight of 419.50 g/mol. Its IUPAC name is [4-[2-(1-ethynylcyclopropyl)oxy-2-oxoethoxy]-3-fluorophenyl]-diphenylsulfanium.
| Compound Name | [4-[2-(1-ethynylcyclopropyl)oxy-2-oxoethoxy]-3-fluorophenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 169050571 |
| Molecular Formula | C25H20FO3S+ |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | [4-[2-(1-ethynylcyclopropyl)oxy-2-oxoethoxy]-3-fluorophenyl]-diphenylsulfanium |
| SMILES | C#CC1(OC(=O)COc2ccc([S+](c3ccccc3)c3ccccc3)cc2F)CC1 |
| InChI | InChI=1S/C25H20FO3S/c1-2-25(15-16-25)29-24(27)18-28-23-14-13-21(17-22(23)26)30(19-9-5-3-6-10-19)20-11-7-4-8-12-20/h1,3-14,17H,15-16,18H2/q+1 |
| InChIKey | ONLQTFNDHLRXIF-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|