C26H27O3S+ — CID 59602382
[4-[2-(1-methylcyclopentyl)oxy-2-oxoethoxy]phenyl]-diphenylsulfanium (PubChem CID 59602382) has the molecular formula C26H27O3S+ and a molecular weight of 419.57 g/mol. Its IUPAC name is [4-[2-(1-methylcyclopentyl)oxy-2-oxoethoxy]phenyl]-diphenylsulfanium.
| Compound Name | [4-[2-(1-methylcyclopentyl)oxy-2-oxoethoxy]phenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 59602382 |
| Molecular Formula | C26H27O3S+ |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | [4-[2-(1-methylcyclopentyl)oxy-2-oxoethoxy]phenyl]-diphenylsulfanium |
| SMILES | CC1(OC(=O)COc2ccc([S+](c3ccccc3)c3ccccc3)cc2)CCCC1 |
| InChI | InChI=1S/C26H27O3S/c1-26(18-8-9-19-26)29-25(27)20-28-21-14-16-24(17-15-21)30(22-10-4-2-5-11-22)23-12-6-3-7-13-23/h2-7,10-17H,8-9,18-20H2,1H3/q+1 |
| InChIKey | LKZSORXCXTUWJJ-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|