C26H27ClO3S — CID 177003329
(1-methylcyclopentyl) 2-[4-[chloro(diphenyl)-λ4-sulfanyl]phenoxy]acetate (PubChem CID 177003329) has the molecular formula C26H27ClO3S and a molecular weight of 455.02 g/mol. Its IUPAC name is (1-methylcyclopentyl) 2-[4-[chloro(diphenyl)-λ4-sulfanyl]phenoxy]acetate.
| Compound Name | (1-methylcyclopentyl) 2-[4-[chloro(diphenyl)-λ4-sulfanyl]phenoxy]acetate |
|---|---|
| PubChem CID | 177003329 |
| Molecular Formula | C26H27ClO3S |
| Molecular Weight | 455.02 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | (1-methylcyclopentyl) 2-[4-[chloro(diphenyl)-λ4-sulfanyl]phenoxy]acetate |
| SMILES | CC1(OC(=O)COc2ccc(S(Cl)(c3ccccc3)c3ccccc3)cc2)CCCC1 |
| InChI | InChI=1S/C26H27ClO3S/c1-26(18-8-9-19-26)30-25(28)20-29-21-14-16-24(17-15-21)31(27,22-10-4-2-5-11-22)23-12-6-3-7-13-23/h2-7,10-17H,8-9,18-20H2,1H3 |
| InChIKey | WSNLKMJDQGYHLV-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.02 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |