C19H22O6 — CID 118503797
[4-[3-(1-methylcyclopentyl)oxy-2,3-dioxopropoxy]phenyl] 2-methylprop-2-enoate (PubChem CID 118503797) has the molecular formula C19H22O6 and a molecular weight of 346.38 g/mol. Its IUPAC name is [4-[3-(1-methylcyclopentyl)oxy-2,3-dioxopropoxy]phenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[3-(1-methylcyclopentyl)oxy-2,3-dioxopropoxy]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 118503797 |
| Molecular Formula | C19H22O6 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | [4-[3-(1-methylcyclopentyl)oxy-2,3-dioxopropoxy]phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(OCC(=O)C(=O)OC2(C)CCCC2)cc1 |
| InChI | InChI=1S/C19H22O6/c1-13(2)17(21)24-15-8-6-14(7-9-15)23-12-16(20)18(22)25-19(3)10-4-5-11-19/h6-9H,1,4-5,10-12H2,2-3H3 |
| InChIKey | RWQOZJRXIFHSKP-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|