C30H32IO5S+ — CID 156684073
[4-(2-iodopropanoyloxy)phenyl]-[4-[2-(1-methylcyclohexyl)oxy-2-oxoethoxy]phenyl]-phenylsulfanium (PubChem CID 156684073) has the molecular formula C30H32IO5S+ and a molecular weight of 631.55 g/mol. Its IUPAC name is [4-(2-iodopropanoyloxy)phenyl]-[4-[2-(1-methylcyclohexyl)oxy-2-oxoethoxy]phenyl]-phenylsulfanium.
| Compound Name | [4-(2-iodopropanoyloxy)phenyl]-[4-[2-(1-methylcyclohexyl)oxy-2-oxoethoxy]phenyl]-phenylsulfanium |
|---|---|
| PubChem CID | 156684073 |
| Molecular Formula | C30H32IO5S+ |
| Molecular Weight | 631.55 g/mol |
| Exact Mass | 631.10 |
| IUPAC Name | [4-(2-iodopropanoyloxy)phenyl]-[4-[2-(1-methylcyclohexyl)oxy-2-oxoethoxy]phenyl]-phenylsulfanium |
| SMILES | CC(I)C(=O)Oc1ccc([S+](c2ccccc2)c2ccc(OCC(=O)OC3(C)CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C30H32IO5S/c1-22(31)29(33)35-24-13-17-27(18-14-24)37(25-9-5-3-6-10-25)26-15-11-23(12-16-26)34-21-28(32)36-30(2)19-7-4-8-20-30/h3,5-6,9-18,22H,4,7-8,19-21H2,1-2H3/q+1 |
| InChIKey | LKYDAYLCKSPUPO-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.55 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|