C28H29I2O2S+ — CID 156683838
(4-cyclohexylphenyl)-[4-[3-iodo-2-(iodomethyl)propanoyl]oxyphenyl]-phenylsulfanium (PubChem CID 156683838) has the molecular formula C28H29I2O2S+ and a molecular weight of 683.41 g/mol. Its IUPAC name is (4-cyclohexylphenyl)-[4-[3-iodo-2-(iodomethyl)propanoyl]oxyphenyl]-phenylsulfanium.
| Compound Name | (4-cyclohexylphenyl)-[4-[3-iodo-2-(iodomethyl)propanoyl]oxyphenyl]-phenylsulfanium |
|---|---|
| PubChem CID | 156683838 |
| Molecular Formula | C28H29I2O2S+ |
| Molecular Weight | 683.41 g/mol |
| Exact Mass | 683.00 |
| IUPAC Name | (4-cyclohexylphenyl)-[4-[3-iodo-2-(iodomethyl)propanoyl]oxyphenyl]-phenylsulfanium |
| SMILES | O=C(Oc1ccc([S+](c2ccccc2)c2ccc(C3CCCCC3)cc2)cc1)C(CI)CI |
| InChI | InChI=1S/C28H29I2O2S/c29-19-23(20-30)28(31)32-24-13-17-27(18-14-24)33(25-9-5-2-6-10-25)26-15-11-22(12-16-26)21-7-3-1-4-8-21/h2,5-6,9-18,21,23H,1,3-4,7-8,19-20H2/q+1 |
| InChIKey | VJNWBNVNLPUOCV-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.41 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|