C32H28F3O4S+ — CID 169017405
[4-[2-oxo-2-[1-[4-(trifluoromethoxy)phenyl]cyclopentyl]oxyethoxy]phenyl]-diphenylsulfanium (PubChem CID 169017405) has the molecular formula C32H28F3O4S+ and a molecular weight of 565.63 g/mol. Its IUPAC name is [4-[2-oxo-2-[1-[4-(trifluoromethoxy)phenyl]cyclopentyl]oxyethoxy]phenyl]-diphenylsulfanium.
| Compound Name | [4-[2-oxo-2-[1-[4-(trifluoromethoxy)phenyl]cyclopentyl]oxyethoxy]phenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 169017405 |
| Molecular Formula | C32H28F3O4S+ |
| Molecular Weight | 565.63 g/mol |
| Exact Mass | 565.17 |
| IUPAC Name | [4-[2-oxo-2-[1-[4-(trifluoromethoxy)phenyl]cyclopentyl]oxyethoxy]phenyl]-diphenylsulfanium |
| SMILES | O=C(COc1ccc([S+](c2ccccc2)c2ccccc2)cc1)OC1(c2ccc(OC(F)(F)F)cc2)CCCC1 |
| InChI | InChI=1S/C32H28F3O4S/c33-32(34,35)38-26-15-13-24(14-16-26)31(21-7-8-22-31)39-30(36)23-37-25-17-19-29(20-18-25)40(27-9-3-1-4-10-27)28-11-5-2-6-12-28/h1-6,9-20H,7-8,21-23H2/q+1 |
| InChIKey | JPINHCUPFGPNPY-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.63 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|