About chlorosulfonyl 2-phenoxyacetate
chlorosulfonyl 2-phenoxyacetate (PubChem CID 87253994) has the molecular formula C8H7ClO5S
and a molecular weight of 250.66 g/mol. Its IUPAC name is chlorosulfonyl 2-phenoxyacetate.
Molecular Properties
| Compound Name | chlorosulfonyl 2-phenoxyacetate |
| PubChem CID | 87253994 |
| Molecular Formula | C8H7ClO5S |
| Molecular Weight | 250.66 g/mol |
| Exact Mass | 249.97 |
| IUPAC Name | chlorosulfonyl 2-phenoxyacetate |
| SMILES | O=C(COc1ccccc1)OS(=O)(=O)Cl |
| InChI | InChI=1S/C8H7ClO5S/c9-15(11,12)14-8(10)6-13-7-4-2-1-3-5-7/h1-5H,6H2 |
| InChIKey | UOSXJGRHHNUUKX-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.66 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze chlorosulfonyl 2-phenoxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chlorosulfonyl 2-phenoxyacetate?
The IUPAC name of chlorosulfonyl 2-phenoxyacetate (CID 87253994) is chlorosulfonyl 2-phenoxyacetate.
What is the SMILES notation for chlorosulfonyl 2-phenoxyacetate?
The canonical SMILES for chlorosulfonyl 2-phenoxyacetate is O=C(COc1ccccc1)OS(=O)(=O)Cl.
What is the InChIKey of chlorosulfonyl 2-phenoxyacetate?
The InChIKey is UOSXJGRHHNUUKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7ClO5S/c9-15(11,12)14-8(10)6-13-7-4-2-1-3-5-7/h1-5H,6H2.
What are the key properties of chlorosulfonyl 2-phenoxyacetate?
chlorosulfonyl 2-phenoxyacetate has a molecular weight of 250.66 g/mol, XLogP of 1.09, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for chlorosulfonyl 2-phenoxyacetate is sourced from PubChem (CID 87253994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).