About chlorosulfonyl benzoate;hydrochloride
chlorosulfonyl benzoate;hydrochloride (PubChem CID 87590926) has the molecular formula C7H6Cl2O4S
and a molecular weight of 257.09 g/mol. Its IUPAC name is chlorosulfonyl benzoate;hydrochloride.
Molecular Properties
| Compound Name | chlorosulfonyl benzoate;hydrochloride |
| PubChem CID | 87590926 |
| Molecular Formula | C7H6Cl2O4S |
| Molecular Weight | 257.09 g/mol |
| Exact Mass | 255.94 |
| IUPAC Name | chlorosulfonyl benzoate;hydrochloride |
| SMILES | Cl.O=C(OS(=O)(=O)Cl)c1ccccc1 |
| InChI | InChI=1S/C7H5ClO4S.ClH/c8-13(10,11)12-7(9)6-4-2-1-3-5-6;/h1-5H;1H |
| InChIKey | IHDPLIVLIRGNIF-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.09 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze chlorosulfonyl benzoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chlorosulfonyl benzoate;hydrochloride?
The IUPAC name of chlorosulfonyl benzoate;hydrochloride (CID 87590926) is chlorosulfonyl benzoate;hydrochloride.
What is the SMILES notation for chlorosulfonyl benzoate;hydrochloride?
The canonical SMILES for chlorosulfonyl benzoate;hydrochloride is Cl.O=C(OS(=O)(=O)Cl)c1ccccc1.
What is the InChIKey of chlorosulfonyl benzoate;hydrochloride?
The InChIKey is IHDPLIVLIRGNIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5ClO4S.ClH/c8-13(10,11)12-7(9)6-4-2-1-3-5-6;/h1-5H;1H.
What are the key properties of chlorosulfonyl benzoate;hydrochloride?
chlorosulfonyl benzoate;hydrochloride has a molecular weight of 257.09 g/mol, XLogP of 1.75, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for chlorosulfonyl benzoate;hydrochloride is sourced from PubChem (CID 87590926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).