About alumane;azane;sulfo benzoate
alumane;azane;sulfo benzoate (PubChem CID 173410767) has the molecular formula C7H12AlNO5S
and a molecular weight of 249.22 g/mol. Its IUPAC name is alumane;azane;sulfo benzoate.
Molecular Properties
| Compound Name | alumane;azane;sulfo benzoate |
| PubChem CID | 173410767 |
| Molecular Formula | C7H12AlNO5S |
| Molecular Weight | 249.22 g/mol |
| Exact Mass | 249.03 |
| IUPAC Name | alumane;azane;sulfo benzoate |
| SMILES | N.O=C(OS(=O)(=O)O)c1ccccc1.[AlH3] |
| InChI | InChI=1S/C7H6O5S.Al.H3N.3H/c8-7(12-13(9,10)11)6-4-2-1-3-5-6;;;;;/h1-5H,(H,9,10,11);;1H3;;; |
| InChIKey | KKKXFODQJQBHNE-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 115.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.22 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze alumane;azane;sulfo benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of alumane;azane;sulfo benzoate?
The IUPAC name of alumane;azane;sulfo benzoate (CID 173410767) is alumane;azane;sulfo benzoate.
What is the SMILES notation for alumane;azane;sulfo benzoate?
The canonical SMILES for alumane;azane;sulfo benzoate is N.O=C(OS(=O)(=O)O)c1ccccc1.[AlH3].
What is the InChIKey of alumane;azane;sulfo benzoate?
The InChIKey is KKKXFODQJQBHNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O5S.Al.H3N.3H/c8-7(12-13(9,10)11)6-4-2-1-3-5-6;;;;;/h1-5H,(H,9,10,11);;1H3;;;.
What are the key properties of alumane;azane;sulfo benzoate?
alumane;azane;sulfo benzoate has a molecular weight of 249.22 g/mol, XLogP of -0.38, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for alumane;azane;sulfo benzoate is sourced from PubChem (CID 173410767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).