C15H16NO7- — CID 166021272
4-[2-(1-methylcyclopentyl)oxy-2-oxoethoxy]-2-nitrobenzoate (PubChem CID 166021272) has the molecular formula C15H16NO7- and a molecular weight of 322.29 g/mol. Its IUPAC name is 4-[2-(1-methylcyclopentyl)oxy-2-oxoethoxy]-2-nitrobenzoate.
| Compound Name | 4-[2-(1-methylcyclopentyl)oxy-2-oxoethoxy]-2-nitrobenzoate |
|---|---|
| PubChem CID | 166021272 |
| Molecular Formula | C15H16NO7- |
| Molecular Weight | 322.29 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | 4-[2-(1-methylcyclopentyl)oxy-2-oxoethoxy]-2-nitrobenzoate |
| SMILES | CC1(OC(=O)COc2ccc(C(=O)[O-])c([N+](=O)[O-])c2)CCCC1 |
| InChI | InChI=1S/C15H17NO7/c1-15(6-2-3-7-15)23-13(17)9-22-10-4-5-11(14(18)19)12(8-10)16(20)21/h4-5,8H,2-3,6-7,9H2,1H3,(H,18,19)/p-1 |
| InChIKey | BVGKEISBKXPJQI-UHFFFAOYSA-M |
| XLogP | 1.21 |
| TPSA | 118.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.29 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|