C16H19O6- — CID 155650683
2-carboxy-4-[2-(1-ethylcyclopentyl)oxy-2-oxoethoxy]phenolate (PubChem CID 155650683) has the molecular formula C16H19O6- and a molecular weight of 307.32 g/mol. Its IUPAC name is 2-carboxy-4-[2-(1-ethylcyclopentyl)oxy-2-oxoethoxy]phenolate.
| Compound Name | 2-carboxy-4-[2-(1-ethylcyclopentyl)oxy-2-oxoethoxy]phenolate |
|---|---|
| PubChem CID | 155650683 |
| Molecular Formula | C16H19O6- |
| Molecular Weight | 307.32 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 2-carboxy-4-[2-(1-ethylcyclopentyl)oxy-2-oxoethoxy]phenolate |
| SMILES | CCC1(OC(=O)COc2ccc([O-])c(C(=O)O)c2)CCCC1 |
| InChI | InChI=1S/C16H20O6/c1-2-16(7-3-4-8-16)22-14(18)10-21-11-5-6-13(17)12(9-11)15(19)20/h5-6,9,17H,2-4,7-8,10H2,1H3,(H,19,20)/p-1 |
| InChIKey | UBXYQOKXXQBDOA-UHFFFAOYSA-M |
| XLogP | 2.10 |
| TPSA | 95.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.32 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |