C44H46I5O8+ — CID 169283568
bis[4-[[4-[2-(1-ethylcyclopentyl)oxy-2-oxoethoxy]-3,5-diiodophenyl]methoxy]phenyl]iodanium (PubChem CID 169283568) has the molecular formula C44H46I5O8+ and a molecular weight of 1337.36 g/mol. Its IUPAC name is bis[4-[[4-[2-(1-ethylcyclopentyl)oxy-2-oxoethoxy]-3,5-diiodophenyl]methoxy]phenyl]iodanium.
| Compound Name | bis[4-[[4-[2-(1-ethylcyclopentyl)oxy-2-oxoethoxy]-3,5-diiodophenyl]methoxy]phenyl]iodanium |
|---|---|
| PubChem CID | 169283568 |
| Molecular Formula | C44H46I5O8+ |
| Molecular Weight | 1337.36 g/mol |
| Exact Mass | 1336.84 |
| IUPAC Name | bis[4-[[4-[2-(1-ethylcyclopentyl)oxy-2-oxoethoxy]-3,5-diiodophenyl]methoxy]phenyl]iodanium |
| SMILES | CCC1(OC(=O)COc2c(I)cc(COc3ccc([I+]c4ccc(OCc5cc(I)c(OCC(=O)OC6(CC)CCCC6)c(I)c5)cc4)cc3)cc2I)CCCC1 |
| InChI | InChI=1S/C44H46I5O8/c1-3-43(17-5-6-18-43)56-39(50)27-54-41-35(45)21-29(22-36(41)46)25-52-33-13-9-31(10-14-33)49-32-11-15-34(16-12-32)53-26-30-23-37(47)42(38(48)24-30)55-28-40(51)57-44(4-2)19-7-8-20-44/h9-16,21-24H,3-8,17-20,25-28H2,1-2H3/q+1 |
| InChIKey | MFEZABSWJMDDGA-UHFFFAOYSA-N |
| XLogP | 8.68 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1337.36 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|