C29H42O4 — CID 144690786
4-butan-2-ylphenol;(1-ethylcyclopentyl) 2-(4-butan-2-ylphenoxy)acetate (PubChem CID 144690786) has the molecular formula C29H42O4 and a molecular weight of 454.65 g/mol. Its IUPAC name is 4-butan-2-ylphenol;(1-ethylcyclopentyl) 2-(4-butan-2-ylphenoxy)acetate.
| Compound Name | 4-butan-2-ylphenol;(1-ethylcyclopentyl) 2-(4-butan-2-ylphenoxy)acetate |
|---|---|
| PubChem CID | 144690786 |
| Molecular Formula | C29H42O4 |
| Molecular Weight | 454.65 g/mol |
| Exact Mass | 454.31 |
| IUPAC Name | 4-butan-2-ylphenol;(1-ethylcyclopentyl) 2-(4-butan-2-ylphenoxy)acetate |
| SMILES | CCC(C)c1ccc(O)cc1.CCC(C)c1ccc(OCC(=O)OC2(CC)CCCC2)cc1 |
| InChI | InChI=1S/C19H28O3.C10H14O/c1-4-15(3)16-8-10-17(11-9-16)21-14-18(20)22-19(5-2)12-6-7-13-19;1-3-8(2)9-4-6-10(11)7-5-9/h8-11,15H,4-7,12-14H2,1-3H3;4-8,11H,3H2,1-2H3 |
| InChIKey | WFWIOZSVNBUPGA-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.65 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |