C28H42O3 — CID 59267017
(2-hexyl-2-adamantyl) 2-(4-butan-2-ylphenoxy)acetate (PubChem CID 59267017) has the molecular formula C28H42O3 and a molecular weight of 426.64 g/mol. Its IUPAC name is (2-hexyl-2-adamantyl) 2-(4-butan-2-ylphenoxy)acetate.
| Compound Name | (2-hexyl-2-adamantyl) 2-(4-butan-2-ylphenoxy)acetate |
|---|---|
| PubChem CID | 59267017 |
| Molecular Formula | C28H42O3 |
| Molecular Weight | 426.64 g/mol |
| Exact Mass | 426.31 |
| IUPAC Name | (2-hexyl-2-adamantyl) 2-(4-butan-2-ylphenoxy)acetate |
| SMILES | CCCCCCC1(OC(=O)COc2ccc(C(C)CC)cc2)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C28H42O3/c1-4-6-7-8-13-28(24-15-21-14-22(17-24)18-25(28)16-21)31-27(29)19-30-26-11-9-23(10-12-26)20(3)5-2/h9-12,20-22,24-25H,4-8,13-19H2,1-3H3 |
| InChIKey | QGEMTBGEMOGNHN-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.64 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|