C29H31O3S+ — CID 86712459
(1-ethylcyclopentyl) 2-(4-dibenzothiophen-5-ium-5-yl-2,6-dimethylphenoxy)acetate (PubChem CID 86712459) has the molecular formula C29H31O3S+ and a molecular weight of 459.63 g/mol. Its IUPAC name is (1-ethylcyclopentyl) 2-(4-dibenzothiophen-5-ium-5-yl-2,6-dimethylphenoxy)acetate.
| Compound Name | (1-ethylcyclopentyl) 2-(4-dibenzothiophen-5-ium-5-yl-2,6-dimethylphenoxy)acetate |
|---|---|
| PubChem CID | 86712459 |
| Molecular Formula | C29H31O3S+ |
| Molecular Weight | 459.63 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | (1-ethylcyclopentyl) 2-(4-dibenzothiophen-5-ium-5-yl-2,6-dimethylphenoxy)acetate |
| SMILES | CCC1(OC(=O)COc2c(C)cc(-[s+]3c4ccccc4c4ccccc43)cc2C)CCCC1 |
| InChI | InChI=1S/C29H31O3S/c1-4-29(15-9-10-16-29)32-27(30)19-31-28-20(2)17-22(18-21(28)3)33-25-13-7-5-11-23(25)24-12-6-8-14-26(24)33/h5-8,11-14,17-18H,4,9-10,15-16,19H2,1-3H3/q+1 |
| InChIKey | DOZALMQRVQMIQK-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.63 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|