C33H35O5S+ — CID 140752749
[2-(1-ethylcyclopentyl)oxy-2-oxoethyl] 10-(4-tert-butylphenyl)-9-oxothioxanthen-10-ium-2-carboxylate (PubChem CID 140752749) has the molecular formula C33H35O5S+ and a molecular weight of 543.71 g/mol. Its IUPAC name is [2-(1-ethylcyclopentyl)oxy-2-oxoethyl] 10-(4-tert-butylphenyl)-9-oxothioxanthen-10-ium-2-carboxylate.
| Compound Name | [2-(1-ethylcyclopentyl)oxy-2-oxoethyl] 10-(4-tert-butylphenyl)-9-oxothioxanthen-10-ium-2-carboxylate |
|---|---|
| PubChem CID | 140752749 |
| Molecular Formula | C33H35O5S+ |
| Molecular Weight | 543.71 g/mol |
| Exact Mass | 543.22 |
| IUPAC Name | [2-(1-ethylcyclopentyl)oxy-2-oxoethyl] 10-(4-tert-butylphenyl)-9-oxothioxanthen-10-ium-2-carboxylate |
| SMILES | CCC1(OC(=O)COC(=O)c2ccc3c(c2)c(=O)c2ccccc2[s+]3-c2ccc(C(C)(C)C)cc2)CCCC1 |
| InChI | InChI=1S/C33H35O5S/c1-5-33(18-8-9-19-33)38-29(34)21-37-31(36)22-12-17-28-26(20-22)30(35)25-10-6-7-11-27(25)39(28)24-15-13-23(14-16-24)32(2,3)4/h6-7,10-17,20H,5,8-9,18-19,21H2,1-4H3/q+1 |
| InChIKey | DQBJFJZYOXIRKG-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.71 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|