C28H25O5S+ — CID 169050889
[2-(2-methylpent-3-yn-2-yloxy)-2-oxoethyl] 3-dibenzothiophen-5-ium-5-yl-4-methoxybenzoate (PubChem CID 169050889) has the molecular formula C28H25O5S+ and a molecular weight of 473.57 g/mol. Its IUPAC name is [2-(2-methylpent-3-yn-2-yloxy)-2-oxoethyl] 3-dibenzothiophen-5-ium-5-yl-4-methoxybenzoate.
| Compound Name | [2-(2-methylpent-3-yn-2-yloxy)-2-oxoethyl] 3-dibenzothiophen-5-ium-5-yl-4-methoxybenzoate |
|---|---|
| PubChem CID | 169050889 |
| Molecular Formula | C28H25O5S+ |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | [2-(2-methylpent-3-yn-2-yloxy)-2-oxoethyl] 3-dibenzothiophen-5-ium-5-yl-4-methoxybenzoate |
| SMILES | CC#CC(C)(C)OC(=O)COC(=O)c1ccc(OC)c(-[s+]2c3ccccc3c3ccccc32)c1 |
| InChI | InChI=1S/C28H25O5S/c1-5-16-28(2,3)33-26(29)18-32-27(30)19-14-15-22(31-4)25(17-19)34-23-12-8-6-10-20(23)21-11-7-9-13-24(21)34/h6-15,17H,18H2,1-4H3/q+1 |
| InChIKey | ZIPUBYYILBRTKG-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|