About naphthalen-1-ylmethyl 3-ethoxy-4-methoxybenzoate
naphthalen-1-ylmethyl 3-ethoxy-4-methoxybenzoate (PubChem CID 7906497) has the molecular formula C21H20O4
and a molecular weight of 336.39 g/mol. Its IUPAC name is naphthalen-1-ylmethyl 3-ethoxy-4-methoxybenzoate.
Molecular Properties
| Compound Name | naphthalen-1-ylmethyl 3-ethoxy-4-methoxybenzoate |
| PubChem CID | 7906497 |
| Molecular Formula | C21H20O4 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | naphthalen-1-ylmethyl 3-ethoxy-4-methoxybenzoate |
| SMILES | CCOc1cc(C(=O)OCc2cccc3ccccc23)ccc1OC |
| InChI | InChI=1S/C21H20O4/c1-3-24-20-13-16(11-12-19(20)23-2)21(22)25-14-17-9-6-8-15-7-4-5-10-18(15)17/h4-13H,3,14H2,1-2H3 |
| InChIKey | OCFJORGMRIMWJO-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze naphthalen-1-ylmethyl 3-ethoxy-4-methoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalen-1-ylmethyl 3-ethoxy-4-methoxybenzoate?
The IUPAC name of naphthalen-1-ylmethyl 3-ethoxy-4-methoxybenzoate (CID 7906497) is naphthalen-1-ylmethyl 3-ethoxy-4-methoxybenzoate.
What is the SMILES notation for naphthalen-1-ylmethyl 3-ethoxy-4-methoxybenzoate?
The canonical SMILES for naphthalen-1-ylmethyl 3-ethoxy-4-methoxybenzoate is CCOc1cc(C(=O)OCc2cccc3ccccc23)ccc1OC.
What is the InChIKey of naphthalen-1-ylmethyl 3-ethoxy-4-methoxybenzoate?
The InChIKey is OCFJORGMRIMWJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20O4/c1-3-24-20-13-16(11-12-19(20)23-2)21(22)25-14-17-9-6-8-15-7-4-5-10-18(15)17/h4-13H,3,14H2,1-2H3.
What are the key properties of naphthalen-1-ylmethyl 3-ethoxy-4-methoxybenzoate?
naphthalen-1-ylmethyl 3-ethoxy-4-methoxybenzoate has a molecular weight of 336.39 g/mol, XLogP of 4.60, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalen-1-ylmethyl 3-ethoxy-4-methoxybenzoate is sourced from PubChem (CID 7906497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).