C23H18BrO3S+ — CID 156684135
[4-(9-oxothioxanthen-10-ium-10-yl)phenyl] 2-bromo-2-methylpropanoate (PubChem CID 156684135) has the molecular formula C23H18BrO3S+ and a molecular weight of 454.37 g/mol. Its IUPAC name is [4-(9-oxothioxanthen-10-ium-10-yl)phenyl] 2-bromo-2-methylpropanoate.
| Compound Name | [4-(9-oxothioxanthen-10-ium-10-yl)phenyl] 2-bromo-2-methylpropanoate |
|---|---|
| PubChem CID | 156684135 |
| Molecular Formula | C23H18BrO3S+ |
| Molecular Weight | 454.37 g/mol |
| Exact Mass | 453.02 |
| IUPAC Name | [4-(9-oxothioxanthen-10-ium-10-yl)phenyl] 2-bromo-2-methylpropanoate |
| SMILES | CC(C)(Br)C(=O)Oc1ccc(-[s+]2c3ccccc3c(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C23H18BrO3S/c1-23(2,24)22(26)27-15-11-13-16(14-12-15)28-19-9-5-3-7-17(19)21(25)18-8-4-6-10-20(18)28/h3-14H,1-2H3/q+1 |
| InChIKey | HUUZIVZQIUZHRJ-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.37 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|