C42H42Br4O8 — CID 140527532
[4-[1,2,2-tris[4-(2-bromo-2-methylpropanoyl)oxyphenyl]ethyl]phenyl] 2-bromo-2-methylpropanoate (PubChem CID 140527532) has the molecular formula C42H42Br4O8 and a molecular weight of 994.41 g/mol. Its IUPAC name is [4-[1,2,2-tris[4-(2-bromo-2-methylpropanoyl)oxyphenyl]ethyl]phenyl] 2-bromo-2-methylpropanoate.
| Compound Name | [4-[1,2,2-tris[4-(2-bromo-2-methylpropanoyl)oxyphenyl]ethyl]phenyl] 2-bromo-2-methylpropanoate |
|---|---|
| PubChem CID | 140527532 |
| Molecular Formula | C42H42Br4O8 |
| Molecular Weight | 994.41 g/mol |
| Exact Mass | 989.96 |
| IUPAC Name | [4-[1,2,2-tris[4-(2-bromo-2-methylpropanoyl)oxyphenyl]ethyl]phenyl] 2-bromo-2-methylpropanoate |
| SMILES | CC(C)(Br)C(=O)Oc1ccc(C(c2ccc(OC(=O)C(C)(C)Br)cc2)C(c2ccc(OC(=O)C(C)(C)Br)cc2)c2ccc(OC(=O)C(C)(C)Br)cc2)cc1 |
| InChI | InChI=1S/C42H42Br4O8/c1-39(2,43)35(47)51-29-17-9-25(10-18-29)33(26-11-19-30(20-12-26)52-36(48)40(3,4)44)34(27-13-21-31(22-14-27)53-37(49)41(5,6)45)28-15-23-32(24-16-28)54-38(50)42(7,8)46/h9-24,33-34H,1-8H3 |
| InChIKey | PBLXYFZVQRHYNR-UHFFFAOYSA-N |
| XLogP | 10.97 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 994.41 |
| LogP ≤ 5 | 10.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|