C28H24O5 — CID 139697360
[4-[1,2,2-tris(4-hydroxyphenyl)ethyl]phenyl] acetate (PubChem CID 139697360) has the molecular formula C28H24O5 and a molecular weight of 440.50 g/mol. Its IUPAC name is [4-[1,2,2-tris(4-hydroxyphenyl)ethyl]phenyl] acetate.
| Compound Name | [4-[1,2,2-tris(4-hydroxyphenyl)ethyl]phenyl] acetate |
|---|---|
| PubChem CID | 139697360 |
| Molecular Formula | C28H24O5 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | [4-[1,2,2-tris(4-hydroxyphenyl)ethyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C(c2ccc(O)cc2)C(c2ccc(O)cc2)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C28H24O5/c1-18(29)33-26-16-8-22(9-17-26)28(21-6-14-25(32)15-7-21)27(19-2-10-23(30)11-3-19)20-4-12-24(31)13-5-20/h2-17,27-28,30-32H,1H3 |
| InChIKey | KTKPQJXFBLWNCL-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|