C24H25Br2O6- — CID 155786549
3,3-bis[4-(2-bromo-2-methylpropanoyl)oxyphenyl]butanoate (PubChem CID 155786549) has the molecular formula C24H25Br2O6- and a molecular weight of 569.27 g/mol. Its IUPAC name is 3,3-bis[4-(2-bromo-2-methylpropanoyl)oxyphenyl]butanoate.
| Compound Name | 3,3-bis[4-(2-bromo-2-methylpropanoyl)oxyphenyl]butanoate |
|---|---|
| PubChem CID | 155786549 |
| Molecular Formula | C24H25Br2O6- |
| Molecular Weight | 569.27 g/mol |
| Exact Mass | 567.00 |
| IUPAC Name | 3,3-bis[4-(2-bromo-2-methylpropanoyl)oxyphenyl]butanoate |
| SMILES | CC(C)(Br)C(=O)Oc1ccc(C(C)(CC(=O)[O-])c2ccc(OC(=O)C(C)(C)Br)cc2)cc1 |
| InChI | InChI=1S/C24H26Br2O6/c1-22(2,25)20(29)31-17-10-6-15(7-11-17)24(5,14-19(27)28)16-8-12-18(13-9-16)32-21(30)23(3,4)26/h6-13H,14H2,1-5H3,(H,27,28)/p-1 |
| InChIKey | IJZNITWVISHGAH-UHFFFAOYSA-M |
| XLogP | 4.29 |
| TPSA | 92.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.27 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|