C11H9BrClO4- — CID 154609353
4-(2-bromo-2-methylpropanoyl)oxy-2-chlorobenzoate (PubChem CID 154609353) has the molecular formula C11H9BrClO4- and a molecular weight of 320.55 g/mol. Its IUPAC name is 4-(2-bromo-2-methylpropanoyl)oxy-2-chlorobenzoate.
| Compound Name | 4-(2-bromo-2-methylpropanoyl)oxy-2-chlorobenzoate |
|---|---|
| PubChem CID | 154609353 |
| Molecular Formula | C11H9BrClO4- |
| Molecular Weight | 320.55 g/mol |
| Exact Mass | 318.94 |
| IUPAC Name | 4-(2-bromo-2-methylpropanoyl)oxy-2-chlorobenzoate |
| SMILES | CC(C)(Br)C(=O)Oc1ccc(C(=O)[O-])c(Cl)c1 |
| InChI | InChI=1S/C11H10BrClO4/c1-11(2,12)10(16)17-6-3-4-7(9(14)15)8(13)5-6/h3-5H,1-2H3,(H,14,15)/p-1 |
| InChIKey | HLFLJZLNTQKLBZ-UHFFFAOYSA-M |
| XLogP | 1.78 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.55 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|