C23H24NO2S+ — CID 58491353
[4-[3-(dimethylamino)-2-oxopropoxy]phenyl]-diphenylsulfanium (PubChem CID 58491353) has the molecular formula C23H24NO2S+ and a molecular weight of 378.52 g/mol. Its IUPAC name is [4-[3-(dimethylamino)-2-oxopropoxy]phenyl]-diphenylsulfanium.
| Compound Name | [4-[3-(dimethylamino)-2-oxopropoxy]phenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 58491353 |
| Molecular Formula | C23H24NO2S+ |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | [4-[3-(dimethylamino)-2-oxopropoxy]phenyl]-diphenylsulfanium |
| SMILES | CN(C)CC(=O)COc1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H24NO2S/c1-24(2)17-19(25)18-26-20-13-15-23(16-14-20)27(21-9-5-3-6-10-21)22-11-7-4-8-12-22/h3-16H,17-18H2,1-2H3/q+1 |
| InChIKey | PHFRGPXYKZLOSY-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|