C28H23F4O3S+ — CID 169051545
bis(3,5-difluorophenyl)-[4-[2-oxo-2-(1-prop-1-ynylcyclopentyl)oxyethoxy]phenyl]sulfanium (PubChem CID 169051545) has the molecular formula C28H23F4O3S+ and a molecular weight of 515.55 g/mol. Its IUPAC name is bis(3,5-difluorophenyl)-[4-[2-oxo-2-(1-prop-1-ynylcyclopentyl)oxyethoxy]phenyl]sulfanium.
| Compound Name | bis(3,5-difluorophenyl)-[4-[2-oxo-2-(1-prop-1-ynylcyclopentyl)oxyethoxy]phenyl]sulfanium |
|---|---|
| PubChem CID | 169051545 |
| Molecular Formula | C28H23F4O3S+ |
| Molecular Weight | 515.55 g/mol |
| Exact Mass | 515.13 |
| IUPAC Name | bis(3,5-difluorophenyl)-[4-[2-oxo-2-(1-prop-1-ynylcyclopentyl)oxyethoxy]phenyl]sulfanium |
| SMILES | CC#CC1(OC(=O)COc2ccc([S+](c3cc(F)cc(F)c3)c3cc(F)cc(F)c3)cc2)CCCC1 |
| InChI | InChI=1S/C28H23F4O3S/c1-2-9-28(10-3-4-11-28)35-27(33)18-34-23-5-7-24(8-6-23)36(25-14-19(29)12-20(30)15-25)26-16-21(31)13-22(32)17-26/h5-8,12-17H,3-4,10-11,18H2,1H3/q+1 |
| InChIKey | FVBFHYJLIDOSKI-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.55 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|