C25H22FO3S+ — CID 169050879
[3-fluoro-4-[2-(2-methylbut-3-yn-2-yloxy)-2-oxoethoxy]phenyl]-diphenylsulfanium (PubChem CID 169050879) has the molecular formula C25H22FO3S+ and a molecular weight of 421.51 g/mol. Its IUPAC name is [3-fluoro-4-[2-(2-methylbut-3-yn-2-yloxy)-2-oxoethoxy]phenyl]-diphenylsulfanium.
| Compound Name | [3-fluoro-4-[2-(2-methylbut-3-yn-2-yloxy)-2-oxoethoxy]phenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 169050879 |
| Molecular Formula | C25H22FO3S+ |
| Molecular Weight | 421.51 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | [3-fluoro-4-[2-(2-methylbut-3-yn-2-yloxy)-2-oxoethoxy]phenyl]-diphenylsulfanium |
| SMILES | C#CC(C)(C)OC(=O)COc1ccc([S+](c2ccccc2)c2ccccc2)cc1F |
| InChI | InChI=1S/C25H22FO3S/c1-4-25(2,3)29-24(27)18-28-23-16-15-21(17-22(23)26)30(19-11-7-5-8-12-19)20-13-9-6-10-14-20/h1,5-17H,18H2,2-3H3/q+1 |
| InChIKey | OYSALCKNUUFNST-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.51 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|