About (1-amino-1-phenylethyl) 2-(2-fluorophenoxy)acetate
(1-amino-1-phenylethyl) 2-(2-fluorophenoxy)acetate (PubChem CID 70557740) has the molecular formula C16H16FNO3
and a molecular weight of 289.31 g/mol. Its IUPAC name is (1-amino-1-phenylethyl) 2-(2-fluorophenoxy)acetate.
Molecular Properties
| Compound Name | (1-amino-1-phenylethyl) 2-(2-fluorophenoxy)acetate |
| PubChem CID | 70557740 |
| Molecular Formula | C16H16FNO3 |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | (1-amino-1-phenylethyl) 2-(2-fluorophenoxy)acetate |
| SMILES | CC(N)(OC(=O)COc1ccccc1F)c1ccccc1 |
| InChI | InChI=1S/C16H16FNO3/c1-16(18,12-7-3-2-4-8-12)21-15(19)11-20-14-10-6-5-9-13(14)17/h2-10H,11,18H2,1H3 |
| InChIKey | AHMBRCPZDNTBDJ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (1-amino-1-phenylethyl) 2-(2-fluorophenoxy)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-amino-1-phenylethyl) 2-(2-fluorophenoxy)acetate?
The IUPAC name of (1-amino-1-phenylethyl) 2-(2-fluorophenoxy)acetate (CID 70557740) is (1-amino-1-phenylethyl) 2-(2-fluorophenoxy)acetate.
What is the SMILES notation for (1-amino-1-phenylethyl) 2-(2-fluorophenoxy)acetate?
The canonical SMILES for (1-amino-1-phenylethyl) 2-(2-fluorophenoxy)acetate is CC(N)(OC(=O)COc1ccccc1F)c1ccccc1.
What is the InChIKey of (1-amino-1-phenylethyl) 2-(2-fluorophenoxy)acetate?
The InChIKey is AHMBRCPZDNTBDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16FNO3/c1-16(18,12-7-3-2-4-8-12)21-15(19)11-20-14-10-6-5-9-13(14)17/h2-10H,11,18H2,1H3.
What are the key properties of (1-amino-1-phenylethyl) 2-(2-fluorophenoxy)acetate?
(1-amino-1-phenylethyl) 2-(2-fluorophenoxy)acetate has a molecular weight of 289.31 g/mol, XLogP of 2.58, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1-amino-1-phenylethyl) 2-(2-fluorophenoxy)acetate is sourced from PubChem (CID 70557740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).