C30H25F4O4S+ — CID 169017617
[4-fluoro-3-[2-oxo-2-[2-[4-(trifluoromethoxy)phenyl]propan-2-yloxy]ethoxy]phenyl]-diphenylsulfanium (PubChem CID 169017617) has the molecular formula C30H25F4O4S+ and a molecular weight of 557.59 g/mol. Its IUPAC name is [4-fluoro-3-[2-oxo-2-[2-[4-(trifluoromethoxy)phenyl]propan-2-yloxy]ethoxy]phenyl]-diphenylsulfanium.
| Compound Name | [4-fluoro-3-[2-oxo-2-[2-[4-(trifluoromethoxy)phenyl]propan-2-yloxy]ethoxy]phenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 169017617 |
| Molecular Formula | C30H25F4O4S+ |
| Molecular Weight | 557.59 g/mol |
| Exact Mass | 557.14 |
| IUPAC Name | [4-fluoro-3-[2-oxo-2-[2-[4-(trifluoromethoxy)phenyl]propan-2-yloxy]ethoxy]phenyl]-diphenylsulfanium |
| SMILES | CC(C)(OC(=O)COc1cc([S+](c2ccccc2)c2ccccc2)ccc1F)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C30H25F4O4S/c1-29(2,21-13-15-22(16-14-21)37-30(32,33)34)38-28(35)20-36-27-19-25(17-18-26(27)31)39(23-9-5-3-6-10-23)24-11-7-4-8-12-24/h3-19H,20H2,1-2H3/q+1 |
| InChIKey | NIASFUFALCIYAJ-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.59 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|