C26H26FOS+ — CID 170523584
[4-(1-ethenylcyclohexyl)oxy-3-fluorophenyl]-diphenylsulfanium (PubChem CID 170523584) has the molecular formula C26H26FOS+ and a molecular weight of 405.56 g/mol. Its IUPAC name is [4-(1-ethenylcyclohexyl)oxy-3-fluorophenyl]-diphenylsulfanium.
| Compound Name | [4-(1-ethenylcyclohexyl)oxy-3-fluorophenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 170523584 |
| Molecular Formula | C26H26FOS+ |
| Molecular Weight | 405.56 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | [4-(1-ethenylcyclohexyl)oxy-3-fluorophenyl]-diphenylsulfanium |
| SMILES | C=CC1(Oc2ccc([S+](c3ccccc3)c3ccccc3)cc2F)CCCCC1 |
| InChI | InChI=1S/C26H26FOS/c1-2-26(18-10-5-11-19-26)28-25-17-16-23(20-24(25)27)29(21-12-6-3-7-13-21)22-14-8-4-9-15-22/h2-4,6-9,12-17,20H,1,5,10-11,18-19H2/q+1 |
| InChIKey | HUPBZVRTNRMUIX-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.56 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|