C28H30F3O2S+ — CID 170545450
[3-(1-tert-butylcyclopentyl)oxy-4-(trifluoromethoxy)phenyl]-diphenylsulfanium (PubChem CID 170545450) has the molecular formula C28H30F3O2S+ and a molecular weight of 487.61 g/mol. Its IUPAC name is [3-(1-tert-butylcyclopentyl)oxy-4-(trifluoromethoxy)phenyl]-diphenylsulfanium.
| Compound Name | [3-(1-tert-butylcyclopentyl)oxy-4-(trifluoromethoxy)phenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 170545450 |
| Molecular Formula | C28H30F3O2S+ |
| Molecular Weight | 487.61 g/mol |
| Exact Mass | 487.19 |
| IUPAC Name | [3-(1-tert-butylcyclopentyl)oxy-4-(trifluoromethoxy)phenyl]-diphenylsulfanium |
| SMILES | CC(C)(C)C1(Oc2cc([S+](c3ccccc3)c3ccccc3)ccc2OC(F)(F)F)CCCC1 |
| InChI | InChI=1S/C28H30F3O2S/c1-26(2,3)27(18-10-11-19-27)32-25-20-23(16-17-24(25)33-28(29,30)31)34(21-12-6-4-7-13-21)22-14-8-5-9-15-22/h4-9,12-17,20H,10-11,18-19H2,1-3H3/q+1 |
| InChIKey | WRUACOQRDVWOIJ-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.61 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|