C29H28F3O3S+ — CID 169017887
2-[4-(trifluoromethyl)phenyl]propan-2-yl 2-[2,6-dimethyl-4-(3-methyl-1-benzothiophen-1-ium-1-yl)phenoxy]acetate (PubChem CID 169017887) has the molecular formula C29H28F3O3S+ and a molecular weight of 513.60 g/mol. Its IUPAC name is 2-[4-(trifluoromethyl)phenyl]propan-2-yl 2-[2,6-dimethyl-4-(3-methyl-1-benzothiophen-1-ium-1-yl)phenoxy]acetate.
| Compound Name | 2-[4-(trifluoromethyl)phenyl]propan-2-yl 2-[2,6-dimethyl-4-(3-methyl-1-benzothiophen-1-ium-1-yl)phenoxy]acetate |
|---|---|
| PubChem CID | 169017887 |
| Molecular Formula | C29H28F3O3S+ |
| Molecular Weight | 513.60 g/mol |
| Exact Mass | 513.17 |
| IUPAC Name | 2-[4-(trifluoromethyl)phenyl]propan-2-yl 2-[2,6-dimethyl-4-(3-methyl-1-benzothiophen-1-ium-1-yl)phenoxy]acetate |
| SMILES | Cc1cc(-[s+]2cc(C)c3ccccc32)cc(C)c1OCC(=O)OC(C)(C)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C29H28F3O3S/c1-18-14-23(36-17-20(3)24-8-6-7-9-25(24)36)15-19(2)27(18)34-16-26(33)35-28(4,5)21-10-12-22(13-11-21)29(30,31)32/h6-15,17H,16H2,1-5H3/q+1 |
| InChIKey | WAVSNRQQILRDJW-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.60 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|