C28H28F3O3S2+ — CID 169050839
[2-methyl-4-[4-(trifluoromethylsulfanyl)phenyl]but-3-yn-2-yl] 2-[4-(2,3-dimethylthiophen-1-ium-1-yl)-2,6-dimethylphenoxy]acetate (PubChem CID 169050839) has the molecular formula C28H28F3O3S2+ and a molecular weight of 533.66 g/mol. Its IUPAC name is [2-methyl-4-[4-(trifluoromethylsulfanyl)phenyl]but-3-yn-2-yl] 2-[4-(2,3-dimethylthiophen-1-ium-1-yl)-2,6-dimethylphenoxy]acetate.
| Compound Name | [2-methyl-4-[4-(trifluoromethylsulfanyl)phenyl]but-3-yn-2-yl] 2-[4-(2,3-dimethylthiophen-1-ium-1-yl)-2,6-dimethylphenoxy]acetate |
|---|---|
| PubChem CID | 169050839 |
| Molecular Formula | C28H28F3O3S2+ |
| Molecular Weight | 533.66 g/mol |
| Exact Mass | 533.14 |
| IUPAC Name | [2-methyl-4-[4-(trifluoromethylsulfanyl)phenyl]but-3-yn-2-yl] 2-[4-(2,3-dimethylthiophen-1-ium-1-yl)-2,6-dimethylphenoxy]acetate |
| SMILES | Cc1cc(-[s+]2ccc(C)c2C)cc(C)c1OCC(=O)OC(C)(C)C#Cc1ccc(SC(F)(F)F)cc1 |
| InChI | InChI=1S/C28H28F3O3S2/c1-18-12-14-36(21(18)4)24-15-19(2)26(20(3)16-24)33-17-25(32)34-27(5,6)13-11-22-7-9-23(10-8-22)35-28(29,30)31/h7-10,12,14-16H,17H2,1-6H3/q+1 |
| InChIKey | CHWHWYVHAJDHOZ-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.66 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|